C41H34F6O2 — CID 102089406
2-(4-butylphenyl)-3-[2-[2-(4-butylphenyl)-1-benzofuran-3-yl]-3,3,4,4,5,5-hexafluorocyclopenten-1-yl]-1-benzofuran (PubChem CID 102089406) has the molecular formula C41H34F6O2 and a molecular weight of 672.71 g/mol. Its IUPAC name is 2-(4-butylphenyl)-3-[2-[2-(4-butylphenyl)-1-benzofuran-3-yl]-3,3,4,4,5,5-hexafluorocyclopenten-1-yl]-1-benzofuran.
| Compound Name | 2-(4-butylphenyl)-3-[2-[2-(4-butylphenyl)-1-benzofuran-3-yl]-3,3,4,4,5,5-hexafluorocyclopenten-1-yl]-1-benzofuran |
|---|---|
| PubChem CID | 102089406 |
| Molecular Formula | C41H34F6O2 |
| Molecular Weight | 672.71 g/mol |
| Exact Mass | 672.25 |
| IUPAC Name | 2-(4-butylphenyl)-3-[2-[2-(4-butylphenyl)-1-benzofuran-3-yl]-3,3,4,4,5,5-hexafluorocyclopenten-1-yl]-1-benzofuran |
| SMILES | CCCCc1ccc(-c2oc3ccccc3c2C2=C(c3c(-c4ccc(CCCC)cc4)oc4ccccc34)C(F)(F)C(F)(F)C2(F)F)cc1 |
| InChI | InChI=1S/C41H34F6O2/c1-3-5-11-25-17-21-27(22-18-25)37-33(29-13-7-9-15-31(29)48-37)35-36(40(44,45)41(46,47)39(35,42)43)34-30-14-8-10-16-32(30)49-38(34)28-23-19-26(20-24-28)12-6-4-2/h7-10,13-24H,3-6,11-12H2,1-2H3 |
| InChIKey | FORVFOUPERSANV-UHFFFAOYSA-N |
| XLogP | 13.03 |
| TPSA | 26.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 672.71 |
| LogP ≤ 5 | 13.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|