C31H33NO6 — CID 46303446
N-(4-butylphenyl)-2-[2-(3,4-dimethoxyphenyl)-4-oxochromen-3-yl]oxybutanamide (PubChem CID 46303446) has the molecular formula C31H33NO6 and a molecular weight of 515.61 g/mol. Its IUPAC name is N-(4-butylphenyl)-2-[2-(3,4-dimethoxyphenyl)-4-oxochromen-3-yl]oxybutanamide.
| Compound Name | N-(4-butylphenyl)-2-[2-(3,4-dimethoxyphenyl)-4-oxochromen-3-yl]oxybutanamide |
|---|---|
| PubChem CID | 46303446 |
| Molecular Formula | C31H33NO6 |
| Molecular Weight | 515.61 g/mol |
| Exact Mass | 515.23 |
| IUPAC Name | N-(4-butylphenyl)-2-[2-(3,4-dimethoxyphenyl)-4-oxochromen-3-yl]oxybutanamide |
| SMILES | CCCCc1ccc(NC(=O)C(CC)Oc2c(-c3ccc(OC)c(OC)c3)oc3ccccc3c2=O)cc1 |
| InChI | InChI=1S/C31H33NO6/c1-5-7-10-20-13-16-22(17-14-20)32-31(34)24(6-2)37-30-28(33)23-11-8-9-12-25(23)38-29(30)21-15-18-26(35-3)27(19-21)36-4/h8-9,11-19,24H,5-7,10H2,1-4H3,(H,32,34) |
| InChIKey | IOLSNPVGAAYJQM-UHFFFAOYSA-N |
| XLogP | 6.62 |
| TPSA | 87.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.61 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |