C35H33NO5 — CID 46303153
2-[2-(4-tert-butylphenyl)-4-oxochromen-3-yl]oxy-N-(4-phenoxyphenyl)butanamide (PubChem CID 46303153) has the molecular formula C35H33NO5 and a molecular weight of 547.65 g/mol. Its IUPAC name is 2-[2-(4-tert-butylphenyl)-4-oxochromen-3-yl]oxy-N-(4-phenoxyphenyl)butanamide.
| Compound Name | 2-[2-(4-tert-butylphenyl)-4-oxochromen-3-yl]oxy-N-(4-phenoxyphenyl)butanamide |
|---|---|
| PubChem CID | 46303153 |
| Molecular Formula | C35H33NO5 |
| Molecular Weight | 547.65 g/mol |
| Exact Mass | 547.24 |
| IUPAC Name | 2-[2-(4-tert-butylphenyl)-4-oxochromen-3-yl]oxy-N-(4-phenoxyphenyl)butanamide |
| SMILES | CCC(Oc1c(-c2ccc(C(C)(C)C)cc2)oc2ccccc2c1=O)C(=O)Nc1ccc(Oc2ccccc2)cc1 |
| InChI | InChI=1S/C35H33NO5/c1-5-29(34(38)36-25-19-21-27(22-20-25)39-26-11-7-6-8-12-26)40-33-31(37)28-13-9-10-14-30(28)41-32(33)23-15-17-24(18-16-23)35(2,3)4/h6-22,29H,5H2,1-4H3,(H,36,38) |
| InChIKey | IRJPWNNYQMBUNT-UHFFFAOYSA-N |
| XLogP | 8.35 |
| TPSA | 77.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.65 |
| LogP ≤ 5 | 8.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |