C27H24ClNO5 — CID 46303374
N-(3-chloro-4-methylphenyl)-2-[2-(4-methoxyphenyl)-4-oxochromen-3-yl]oxybutanamide (PubChem CID 46303374) has the molecular formula C27H24ClNO5 and a molecular weight of 477.94 g/mol. Its IUPAC name is N-(3-chloro-4-methylphenyl)-2-[2-(4-methoxyphenyl)-4-oxochromen-3-yl]oxybutanamide.
| Compound Name | N-(3-chloro-4-methylphenyl)-2-[2-(4-methoxyphenyl)-4-oxochromen-3-yl]oxybutanamide |
|---|---|
| PubChem CID | 46303374 |
| Molecular Formula | C27H24ClNO5 |
| Molecular Weight | 477.94 g/mol |
| Exact Mass | 477.13 |
| IUPAC Name | N-(3-chloro-4-methylphenyl)-2-[2-(4-methoxyphenyl)-4-oxochromen-3-yl]oxybutanamide |
| SMILES | CCC(Oc1c(-c2ccc(OC)cc2)oc2ccccc2c1=O)C(=O)Nc1ccc(C)c(Cl)c1 |
| InChI | InChI=1S/C27H24ClNO5/c1-4-22(27(31)29-18-12-9-16(2)21(28)15-18)33-26-24(30)20-7-5-6-8-23(20)34-25(26)17-10-13-19(32-3)14-11-17/h5-15,22H,4H2,1-3H3,(H,29,31) |
| InChIKey | LLNSVNWDICXEAZ-UHFFFAOYSA-N |
| XLogP | 6.23 |
| TPSA | 77.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.94 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |