C27H25NO4 — CID 46302988
N-(2,5-dimethylphenyl)-2-(4-oxo-2-phenylchromen-3-yl)oxybutanamide (PubChem CID 46302988) has the molecular formula C27H25NO4 and a molecular weight of 427.50 g/mol. Its IUPAC name is N-(2,5-dimethylphenyl)-2-(4-oxo-2-phenylchromen-3-yl)oxybutanamide.
| Compound Name | N-(2,5-dimethylphenyl)-2-(4-oxo-2-phenylchromen-3-yl)oxybutanamide |
|---|---|
| PubChem CID | 46302988 |
| Molecular Formula | C27H25NO4 |
| Molecular Weight | 427.50 g/mol |
| Exact Mass | 427.18 |
| IUPAC Name | N-(2,5-dimethylphenyl)-2-(4-oxo-2-phenylchromen-3-yl)oxybutanamide |
| SMILES | CCC(Oc1c(-c2ccccc2)oc2ccccc2c1=O)C(=O)Nc1cc(C)ccc1C |
| InChI | InChI=1S/C27H25NO4/c1-4-22(27(30)28-21-16-17(2)14-15-18(21)3)31-26-24(29)20-12-8-9-13-23(20)32-25(26)19-10-6-5-7-11-19/h5-16,22H,4H2,1-3H3,(H,28,30) |
| InChIKey | ZIBCQAJSZOZNNH-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 68.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.50 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |