C29H28ClNO4 — CID 46303143
2-[2-(4-tert-butylphenyl)-4-oxochromen-3-yl]oxy-N-(3-chlorophenyl)butanamide (PubChem CID 46303143) has the molecular formula C29H28ClNO4 and a molecular weight of 490.00 g/mol. Its IUPAC name is 2-[2-(4-tert-butylphenyl)-4-oxochromen-3-yl]oxy-N-(3-chlorophenyl)butanamide.
| Compound Name | 2-[2-(4-tert-butylphenyl)-4-oxochromen-3-yl]oxy-N-(3-chlorophenyl)butanamide |
|---|---|
| PubChem CID | 46303143 |
| Molecular Formula | C29H28ClNO4 |
| Molecular Weight | 490.00 g/mol |
| Exact Mass | 489.17 |
| IUPAC Name | 2-[2-(4-tert-butylphenyl)-4-oxochromen-3-yl]oxy-N-(3-chlorophenyl)butanamide |
| SMILES | CCC(Oc1c(-c2ccc(C(C)(C)C)cc2)oc2ccccc2c1=O)C(=O)Nc1cccc(Cl)c1 |
| InChI | InChI=1S/C29H28ClNO4/c1-5-23(28(33)31-21-10-8-9-20(30)17-21)34-27-25(32)22-11-6-7-12-24(22)35-26(27)18-13-15-19(16-14-18)29(2,3)4/h6-17,23H,5H2,1-4H3,(H,31,33) |
| InChIKey | WBFPIYQGCRHPRA-UHFFFAOYSA-N |
| XLogP | 7.21 |
| TPSA | 68.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.00 |
| LogP ≤ 5 | 7.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |