C24H27NO2 — CID 28573574
(2R)-N-(4-butylphenyl)-2-naphthalen-2-yloxybutanamide (PubChem CID 28573574) has the molecular formula C24H27NO2 and a molecular weight of 361.49 g/mol. Its IUPAC name is (2R)-N-(4-butylphenyl)-2-naphthalen-2-yloxybutanamide.
| Compound Name | (2R)-N-(4-butylphenyl)-2-naphthalen-2-yloxybutanamide |
|---|---|
| PubChem CID | 28573574 |
| Molecular Formula | C24H27NO2 |
| Molecular Weight | 361.49 g/mol |
| Exact Mass | 361.20 |
| IUPAC Name | (2R)-N-(4-butylphenyl)-2-naphthalen-2-yloxybutanamide |
| SMILES | CCCCc1ccc(NC(=O)[C@@H](CC)Oc2ccc3ccccc3c2)cc1 |
| InChI | InChI=1S/C24H27NO2/c1-3-5-8-18-11-14-21(15-12-18)25-24(26)23(4-2)27-22-16-13-19-9-6-7-10-20(19)17-22/h6-7,9-17,23H,3-5,8H2,1-2H3,(H,25,26)/t23-/m1/s1 |
| InChIKey | UUORVCBWNZHBBD-HSZRJFAPSA-N |
| XLogP | 5.98 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.49 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |