C28H34N4O — CID 3122939
2-[(4-benzhydrylpiperazin-1-yl)iminomethyl]-5-(diethylamino)phenol (PubChem CID 3122939) has the molecular formula C28H34N4O and a molecular weight of 442.61 g/mol. Its IUPAC name is 2-[(4-benzhydrylpiperazin-1-yl)iminomethyl]-5-(diethylamino)phenol.
| Compound Name | 2-[(4-benzhydrylpiperazin-1-yl)iminomethyl]-5-(diethylamino)phenol |
|---|---|
| PubChem CID | 3122939 |
| Molecular Formula | C28H34N4O |
| Molecular Weight | 442.61 g/mol |
| Exact Mass | 442.27 |
| IUPAC Name | 2-[(4-benzhydrylpiperazin-1-yl)iminomethyl]-5-(diethylamino)phenol |
| SMILES | CCN(CC)c1ccc(C=NN2CCN(C(c3ccccc3)c3ccccc3)CC2)c(O)c1 |
| InChI | InChI=1S/C28H34N4O/c1-3-30(4-2)26-16-15-25(27(33)21-26)22-29-32-19-17-31(18-20-32)28(23-11-7-5-8-12-23)24-13-9-6-10-14-24/h5-16,21-22,28,33H,3-4,17-20H2,1-2H3 |
| InChIKey | XWPUHTVBFNCIRV-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 42.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.61 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'hzone_pipzn(79)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|