C39H42F6S2 — CID 102200911
2-heptan-4-yl-3-[3,3,4,4,5,5-hexafluoro-2-(2-heptan-4-yl-5-phenylthiophen-3-yl)cyclopenten-1-yl]-5-phenylthiophene (PubChem CID 102200911) has the molecular formula C39H42F6S2 and a molecular weight of 688.89 g/mol. Its IUPAC name is 2-heptan-4-yl-3-[3,3,4,4,5,5-hexafluoro-2-(2-heptan-4-yl-5-phenylthiophen-3-yl)cyclopenten-1-yl]-5-phenylthiophene.
| Compound Name | 2-heptan-4-yl-3-[3,3,4,4,5,5-hexafluoro-2-(2-heptan-4-yl-5-phenylthiophen-3-yl)cyclopenten-1-yl]-5-phenylthiophene |
|---|---|
| PubChem CID | 102200911 |
| Molecular Formula | C39H42F6S2 |
| Molecular Weight | 688.89 g/mol |
| Exact Mass | 688.26 |
| IUPAC Name | 2-heptan-4-yl-3-[3,3,4,4,5,5-hexafluoro-2-(2-heptan-4-yl-5-phenylthiophen-3-yl)cyclopenten-1-yl]-5-phenylthiophene |
| SMILES | CCCC(CCC)c1sc(-c2ccccc2)cc1C1=C(c2cc(-c3ccccc3)sc2C(CCC)CCC)C(F)(F)C(F)(F)C1(F)F |
| InChI | InChI=1S/C39H42F6S2/c1-5-15-27(16-6-2)35-29(23-31(46-35)25-19-11-9-12-20-25)33-34(38(42,43)39(44,45)37(33,40)41)30-24-32(26-21-13-10-14-22-26)47-36(30)28(17-7-3)18-8-4/h9-14,19-24,27-28H,5-8,15-18H2,1-4H3 |
| InChIKey | XBTMSLOXDRTOQP-UHFFFAOYSA-N |
| XLogP | 14.34 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 688.89 |
| LogP ≤ 5 | 14.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|