C27H18F6S2 — CID 101101183
2-[3,3,4,4,5,5-hexafluoro-2-(3-methyl-5-phenylthiophen-2-yl)cyclopenten-1-yl]-3-methyl-5-phenylthiophene (PubChem CID 101101183) has the molecular formula C27H18F6S2 and a molecular weight of 520.56 g/mol. Its IUPAC name is 2-[3,3,4,4,5,5-hexafluoro-2-(3-methyl-5-phenylthiophen-2-yl)cyclopenten-1-yl]-3-methyl-5-phenylthiophene.
| Compound Name | 2-[3,3,4,4,5,5-hexafluoro-2-(3-methyl-5-phenylthiophen-2-yl)cyclopenten-1-yl]-3-methyl-5-phenylthiophene |
|---|---|
| PubChem CID | 101101183 |
| Molecular Formula | C27H18F6S2 |
| Molecular Weight | 520.56 g/mol |
| Exact Mass | 520.08 |
| IUPAC Name | 2-[3,3,4,4,5,5-hexafluoro-2-(3-methyl-5-phenylthiophen-2-yl)cyclopenten-1-yl]-3-methyl-5-phenylthiophene |
| SMILES | Cc1cc(-c2ccccc2)sc1C1=C(c2sc(-c3ccccc3)cc2C)C(F)(F)C(F)(F)C1(F)F |
| InChI | InChI=1S/C27H18F6S2/c1-15-13-19(17-9-5-3-6-10-17)34-23(15)21-22(26(30,31)27(32,33)25(21,28)29)24-16(2)14-20(35-24)18-11-7-4-8-12-18/h3-14H,1-2H3 |
| InChIKey | DHDYSFLMHFBDTM-UHFFFAOYSA-N |
| XLogP | 9.59 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.56 |
| LogP ≤ 5 | 9.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|