C63H42F6S2 — CID 134393777
5-[4-(2,4-diphenylphenyl)phenyl]-3-[2-[5-[4-(2,4-diphenylphenyl)phenyl]-2-methylthiophen-3-yl]-3,3,4,4,5,5-hexafluorocyclopenten-1-yl]-2-methylthiophene (PubChem CID 134393777) has the molecular formula C63H42F6S2 and a molecular weight of 977.15 g/mol. Its IUPAC name is 5-[4-(2,4-diphenylphenyl)phenyl]-3-[2-[5-[4-(2,4-diphenylphenyl)phenyl]-2-methylthiophen-3-yl]-3,3,4,4,5,5-hexafluorocyclopenten-1-yl]-2-methylthiophene.
| Compound Name | 5-[4-(2,4-diphenylphenyl)phenyl]-3-[2-[5-[4-(2,4-diphenylphenyl)phenyl]-2-methylthiophen-3-yl]-3,3,4,4,5,5-hexafluorocyclopenten-1-yl]-2-methylthiophene |
|---|---|
| PubChem CID | 134393777 |
| Molecular Formula | C63H42F6S2 |
| Molecular Weight | 977.15 g/mol |
| Exact Mass | 976.26 |
| IUPAC Name | 5-[4-(2,4-diphenylphenyl)phenyl]-3-[2-[5-[4-(2,4-diphenylphenyl)phenyl]-2-methylthiophen-3-yl]-3,3,4,4,5,5-hexafluorocyclopenten-1-yl]-2-methylthiophene |
| SMILES | Cc1sc(-c2ccc(-c3ccc(-c4ccccc4)cc3-c3ccccc3)cc2)cc1C1=C(c2cc(-c3ccc(-c4ccc(-c5ccccc5)cc4-c4ccccc4)cc3)sc2C)C(F)(F)C(F)(F)C1(F)F |
| InChI | InChI=1S/C63H42F6S2/c1-39-53(37-57(70-39)47-27-23-45(24-28-47)51-33-31-49(41-15-7-3-8-16-41)35-55(51)43-19-11-5-12-20-43)59-60(62(66,67)63(68,69)61(59,64)65)54-38-58(71-40(54)2)48-29-25-46(26-30-48)52-34-32-50(42-17-9-4-10-18-42)36-56(52)44-21-13-6-14-22-44/h3-38H,1-2H3 |
| InChIKey | NZRRHDJPMAVFOJ-UHFFFAOYSA-N |
| XLogP | 19.59 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 71 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 977.15 |
| LogP ≤ 5 | 19.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|