C65H46F6S2 — CID 101242394
4,14-bis[4-(2,4-diphenylphenyl)phenyl]-8,8,9,9,10,10-hexafluoro-1,2,5,13-tetramethyl-3,15-dithiatetracyclo[10.3.0.02,6.07,11]pentadeca-4,6,11,13-tetraene (PubChem CID 101242394) has the molecular formula C65H46F6S2 and a molecular weight of 1005.21 g/mol. Its IUPAC name is 4,14-bis[4-(2,4-diphenylphenyl)phenyl]-8,8,9,9,10,10-hexafluoro-1,2,5,13-tetramethyl-3,15-dithiatetracyclo[10.3.0.02,6.07,11]pentadeca-4,6,11,13-tetraene.
| Compound Name | 4,14-bis[4-(2,4-diphenylphenyl)phenyl]-8,8,9,9,10,10-hexafluoro-1,2,5,13-tetramethyl-3,15-dithiatetracyclo[10.3.0.02,6.07,11]pentadeca-4,6,11,13-tetraene |
|---|---|
| PubChem CID | 101242394 |
| Molecular Formula | C65H46F6S2 |
| Molecular Weight | 1005.21 g/mol |
| Exact Mass | 1004.29 |
| IUPAC Name | 4,14-bis[4-(2,4-diphenylphenyl)phenyl]-8,8,9,9,10,10-hexafluoro-1,2,5,13-tetramethyl-3,15-dithiatetracyclo[10.3.0.02,6.07,11]pentadeca-4,6,11,13-tetraene |
| SMILES | CC1=C(c2ccc(-c3ccc(-c4ccccc4)cc3-c3ccccc3)cc2)SC2(C)C1=C1C(=C3C(C)=C(c4ccc(-c5ccc(-c6ccccc6)cc5-c5ccccc5)cc4)SC32C)C(F)(F)C(F)(F)C1(F)F |
| InChI | InChI=1S/C65H46F6S2/c1-39-55-57-58(64(68,69)65(70,71)63(57,66)67)56-40(2)60(48-31-27-46(28-32-48)52-36-34-50(42-19-11-6-12-20-42)38-54(52)44-23-15-8-16-24-44)73-62(56,4)61(55,3)72-59(39)47-29-25-45(26-30-47)51-35-33-49(41-17-9-5-10-18-41)37-53(51)43-21-13-7-14-22-43/h5-38H,1-4H3 |
| InChIKey | MXDNSNJSXQPGIQ-UHFFFAOYSA-N |
| XLogP | 19.39 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 73 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1005.21 |
| LogP ≤ 5 | 19.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|