C37H36F6O2S2 — CID 101384556
nonan-2-yl 4-[3,3,4,4,5,5-hexafluoro-2-[2-methyl-5-(4-phenylphenyl)thiophen-3-yl]cyclopenten-1-yl]-5-methylthiophene-2-carboxylate (PubChem CID 101384556) has the molecular formula C37H36F6O2S2 and a molecular weight of 690.82 g/mol. Its IUPAC name is nonan-2-yl 4-[3,3,4,4,5,5-hexafluoro-2-[2-methyl-5-(4-phenylphenyl)thiophen-3-yl]cyclopenten-1-yl]-5-methylthiophene-2-carboxylate.
| Compound Name | nonan-2-yl 4-[3,3,4,4,5,5-hexafluoro-2-[2-methyl-5-(4-phenylphenyl)thiophen-3-yl]cyclopenten-1-yl]-5-methylthiophene-2-carboxylate |
|---|---|
| PubChem CID | 101384556 |
| Molecular Formula | C37H36F6O2S2 |
| Molecular Weight | 690.82 g/mol |
| Exact Mass | 690.21 |
| IUPAC Name | nonan-2-yl 4-[3,3,4,4,5,5-hexafluoro-2-[2-methyl-5-(4-phenylphenyl)thiophen-3-yl]cyclopenten-1-yl]-5-methylthiophene-2-carboxylate |
| SMILES | CCCCCCCC(C)OC(=O)c1cc(C2=C(c3cc(-c4ccc(-c5ccccc5)cc4)sc3C)C(F)(F)C(F)(F)C2(F)F)c(C)s1 |
| InChI | InChI=1S/C37H36F6O2S2/c1-5-6-7-8-10-13-22(2)45-34(44)31-21-29(24(4)47-31)33-32(35(38,39)37(42,43)36(33,40)41)28-20-30(46-23(28)3)27-18-16-26(17-19-27)25-14-11-9-12-15-25/h9,11-12,14-22H,5-8,10,13H2,1-4H3 |
| InChIKey | BFJCQLHVESRAMH-UHFFFAOYSA-N |
| XLogP | 12.50 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 690.82 |
| LogP ≤ 5 | 12.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|