C31H28F6S2Si — CID 156711257
[3-[3,3,4,4,5,5-hexafluoro-2-(5-phenyl-2-propan-2-ylthiophen-3-yl)cyclopenten-1-yl]-5-phenylthiophen-2-yl]-trimethylsilane (PubChem CID 156711257) has the molecular formula C31H28F6S2Si and a molecular weight of 606.77 g/mol. Its IUPAC name is [3-[3,3,4,4,5,5-hexafluoro-2-(5-phenyl-2-propan-2-ylthiophen-3-yl)cyclopenten-1-yl]-5-phenylthiophen-2-yl]-trimethylsilane.
| Compound Name | [3-[3,3,4,4,5,5-hexafluoro-2-(5-phenyl-2-propan-2-ylthiophen-3-yl)cyclopenten-1-yl]-5-phenylthiophen-2-yl]-trimethylsilane |
|---|---|
| PubChem CID | 156711257 |
| Molecular Formula | C31H28F6S2Si |
| Molecular Weight | 606.77 g/mol |
| Exact Mass | 606.13 |
| IUPAC Name | [3-[3,3,4,4,5,5-hexafluoro-2-(5-phenyl-2-propan-2-ylthiophen-3-yl)cyclopenten-1-yl]-5-phenylthiophen-2-yl]-trimethylsilane |
| SMILES | CC(C)c1sc(-c2ccccc2)cc1C1=C(c2cc(-c3ccccc3)sc2[Si](C)(C)C)C(F)(F)C(F)(F)C1(F)F |
| InChI | InChI=1S/C31H28F6S2Si/c1-18(2)27-21(16-23(38-27)19-12-8-6-9-13-19)25-26(30(34,35)31(36,37)29(25,32)33)22-17-24(20-14-10-7-11-15-20)39-28(22)40(3,4)5/h6-18H,1-5H3 |
| InChIKey | XTCRPHDZNWCYDY-UHFFFAOYSA-N |
| XLogP | 10.64 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.77 |
| LogP ≤ 5 | 10.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|