C35H26F6S2 — CID 102354487
3-[3,3,4,4,5,5-hexafluoro-2-(2-pent-1-ynyl-5-phenylthiophen-3-yl)cyclopenten-1-yl]-2-pent-1-ynyl-5-phenylthiophene (PubChem CID 102354487) has the molecular formula C35H26F6S2 and a molecular weight of 624.71 g/mol. Its IUPAC name is 3-[3,3,4,4,5,5-hexafluoro-2-(2-pent-1-ynyl-5-phenylthiophen-3-yl)cyclopenten-1-yl]-2-pent-1-ynyl-5-phenylthiophene.
| Compound Name | 3-[3,3,4,4,5,5-hexafluoro-2-(2-pent-1-ynyl-5-phenylthiophen-3-yl)cyclopenten-1-yl]-2-pent-1-ynyl-5-phenylthiophene |
|---|---|
| PubChem CID | 102354487 |
| Molecular Formula | C35H26F6S2 |
| Molecular Weight | 624.71 g/mol |
| Exact Mass | 624.14 |
| IUPAC Name | 3-[3,3,4,4,5,5-hexafluoro-2-(2-pent-1-ynyl-5-phenylthiophen-3-yl)cyclopenten-1-yl]-2-pent-1-ynyl-5-phenylthiophene |
| SMILES | CCCC#Cc1sc(-c2ccccc2)cc1C1=C(c2cc(-c3ccccc3)sc2C#CCCC)C(F)(F)C(F)(F)C1(F)F |
| InChI | InChI=1S/C35H26F6S2/c1-3-5-9-19-27-25(21-29(42-27)23-15-11-7-12-16-23)31-32(34(38,39)35(40,41)33(31,36)37)26-22-30(24-17-13-8-14-18-24)43-28(26)20-10-6-4-2/h7-8,11-18,21-22H,3-6H2,1-2H3 |
| InChIKey | PTQCFIZEKHEOFP-UHFFFAOYSA-N |
| XLogP | 11.28 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.71 |
| LogP ≤ 5 | 11.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|