C33H14F6N4S2 — CID 177431581
2-[[3-[2-[2-(2,2-dicyanoethenyl)-5-phenylthiophen-3-yl]-3,3,4,4,5,5-hexafluorocyclopenten-1-yl]-5-phenylthiophen-2-yl]methylidene]propanedinitrile (PubChem CID 177431581) has the molecular formula C33H14F6N4S2 and a molecular weight of 644.63 g/mol. Its IUPAC name is 2-[[3-[2-[2-(2,2-dicyanoethenyl)-5-phenylthiophen-3-yl]-3,3,4,4,5,5-hexafluorocyclopenten-1-yl]-5-phenylthiophen-2-yl]methylidene]propanedinitrile.
| Compound Name | 2-[[3-[2-[2-(2,2-dicyanoethenyl)-5-phenylthiophen-3-yl]-3,3,4,4,5,5-hexafluorocyclopenten-1-yl]-5-phenylthiophen-2-yl]methylidene]propanedinitrile |
|---|---|
| PubChem CID | 177431581 |
| Molecular Formula | C33H14F6N4S2 |
| Molecular Weight | 644.63 g/mol |
| Exact Mass | 644.06 |
| IUPAC Name | 2-[[3-[2-[2-(2,2-dicyanoethenyl)-5-phenylthiophen-3-yl]-3,3,4,4,5,5-hexafluorocyclopenten-1-yl]-5-phenylthiophen-2-yl]methylidene]propanedinitrile |
| SMILES | N#CC(C#N)=Cc1sc(-c2ccccc2)cc1C1=C(c2cc(-c3ccccc3)sc2C=C(C#N)C#N)C(F)(F)C(F)(F)C1(F)F |
| InChI | InChI=1S/C33H14F6N4S2/c34-31(35)29(23-13-25(21-7-3-1-4-8-21)44-27(23)11-19(15-40)16-41)30(32(36,37)33(31,38)39)24-14-26(22-9-5-2-6-10-22)45-28(24)12-20(17-42)18-43/h1-14H |
| InChIKey | ZOSQBQVGJNDDNT-UHFFFAOYSA-N |
| XLogP | 9.84 |
| TPSA | 95.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.63 |
| LogP ≤ 5 | 9.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|