C29H20F6N2O3S — CID 89048265
2-[[3,3,4,4,5,5-hexafluoro-2-(2-methyl-5-phenylthiophen-3-yl)cyclopenten-1-yl]-(3,4,5-trimethoxyphenyl)methylidene]propanedinitrile (PubChem CID 89048265) has the molecular formula C29H20F6N2O3S and a molecular weight of 590.55 g/mol. Its IUPAC name is 2-[[3,3,4,4,5,5-hexafluoro-2-(2-methyl-5-phenylthiophen-3-yl)cyclopenten-1-yl]-(3,4,5-trimethoxyphenyl)methylidene]propanedinitrile.
| Compound Name | 2-[[3,3,4,4,5,5-hexafluoro-2-(2-methyl-5-phenylthiophen-3-yl)cyclopenten-1-yl]-(3,4,5-trimethoxyphenyl)methylidene]propanedinitrile |
|---|---|
| PubChem CID | 89048265 |
| Molecular Formula | C29H20F6N2O3S |
| Molecular Weight | 590.55 g/mol |
| Exact Mass | 590.11 |
| IUPAC Name | 2-[[3,3,4,4,5,5-hexafluoro-2-(2-methyl-5-phenylthiophen-3-yl)cyclopenten-1-yl]-(3,4,5-trimethoxyphenyl)methylidene]propanedinitrile |
| SMILES | COc1cc(C(=C(C#N)C#N)C2=C(c3cc(-c4ccccc4)sc3C)C(F)(F)C(F)(F)C2(F)F)cc(OC)c1OC |
| InChI | InChI=1S/C29H20F6N2O3S/c1-15-19(12-22(41-15)16-8-6-5-7-9-16)24-25(28(32,33)29(34,35)27(24,30)31)23(18(13-36)14-37)17-10-20(38-2)26(40-4)21(11-17)39-3/h5-12H,1-4H3 |
| InChIKey | UJBVFVYOMJOJMN-UHFFFAOYSA-N |
| XLogP | 7.92 |
| TPSA | 75.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.55 |
| LogP ≤ 5 | 7.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_cyano_A(19)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|