C49H46F6O4S2 — CID 89484146
3-[2-[2,5-bis(4-methoxy-3,5-dimethylphenyl)thiophen-3-yl]-3,3,4,4,5,5-hexafluorocyclopenten-1-yl]-2,5-bis(4-methoxy-3,5-dimethylphenyl)thiophene (PubChem CID 89484146) has the molecular formula C49H46F6O4S2 and a molecular weight of 877.02 g/mol. Its IUPAC name is 3-[2-[2,5-bis(4-methoxy-3,5-dimethylphenyl)thiophen-3-yl]-3,3,4,4,5,5-hexafluorocyclopenten-1-yl]-2,5-bis(4-methoxy-3,5-dimethylphenyl)thiophene.
| Compound Name | 3-[2-[2,5-bis(4-methoxy-3,5-dimethylphenyl)thiophen-3-yl]-3,3,4,4,5,5-hexafluorocyclopenten-1-yl]-2,5-bis(4-methoxy-3,5-dimethylphenyl)thiophene |
|---|---|
| PubChem CID | 89484146 |
| Molecular Formula | C49H46F6O4S2 |
| Molecular Weight | 877.02 g/mol |
| Exact Mass | 876.27 |
| IUPAC Name | 3-[2-[2,5-bis(4-methoxy-3,5-dimethylphenyl)thiophen-3-yl]-3,3,4,4,5,5-hexafluorocyclopenten-1-yl]-2,5-bis(4-methoxy-3,5-dimethylphenyl)thiophene |
| SMILES | COc1c(C)cc(-c2cc(C3=C(c4cc(-c5cc(C)c(OC)c(C)c5)sc4-c4cc(C)c(OC)c(C)c4)C(F)(F)C(F)(F)C3(F)F)c(-c3cc(C)c(OC)c(C)c3)s2)cc1C |
| InChI | InChI=1S/C49H46F6O4S2/c1-23-13-31(14-24(2)41(23)56-9)37-21-35(45(60-37)33-17-27(5)43(58-11)28(6)18-33)39-40(48(52,53)49(54,55)47(39,50)51)36-22-38(32-15-25(3)42(57-10)26(4)16-32)61-46(36)34-19-29(7)44(59-12)30(8)20-34/h13-22H,1-12H3 |
| InChIKey | WDSKJJPZVBXHKH-UHFFFAOYSA-N |
| XLogP | 14.81 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 877.02 |
| LogP ≤ 5 | 14.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|