C41H24F6N2O2S2 — CID 140707810
4-[4-[3,3,4,4,5,5-hexafluoro-2-[5-(4-isocyanophenyl)-2-(4-methoxyphenyl)thiophen-3-yl]cyclopenten-1-yl]-5-(4-methoxyphenyl)thiophen-2-yl]benzonitrile (PubChem CID 140707810) has the molecular formula C41H24F6N2O2S2 and a molecular weight of 754.78 g/mol. Its IUPAC name is 4-[4-[3,3,4,4,5,5-hexafluoro-2-[5-(4-isocyanophenyl)-2-(4-methoxyphenyl)thiophen-3-yl]cyclopenten-1-yl]-5-(4-methoxyphenyl)thiophen-2-yl]benzonitrile.
| Compound Name | 4-[4-[3,3,4,4,5,5-hexafluoro-2-[5-(4-isocyanophenyl)-2-(4-methoxyphenyl)thiophen-3-yl]cyclopenten-1-yl]-5-(4-methoxyphenyl)thiophen-2-yl]benzonitrile |
|---|---|
| PubChem CID | 140707810 |
| Molecular Formula | C41H24F6N2O2S2 |
| Molecular Weight | 754.78 g/mol |
| Exact Mass | 754.12 |
| IUPAC Name | 4-[4-[3,3,4,4,5,5-hexafluoro-2-[5-(4-isocyanophenyl)-2-(4-methoxyphenyl)thiophen-3-yl]cyclopenten-1-yl]-5-(4-methoxyphenyl)thiophen-2-yl]benzonitrile |
| SMILES | [C-]#[N+]c1ccc(-c2cc(C3=C(c4cc(-c5ccc(C#N)cc5)sc4-c4ccc(OC)cc4)C(F)(F)C(F)(F)C3(F)F)c(-c3ccc(OC)cc3)s2)cc1 |
| InChI | InChI=1S/C41H24F6N2O2S2/c1-49-28-14-8-25(9-15-28)34-21-32(38(53-34)27-12-18-30(51-3)19-13-27)36-35(39(42,43)41(46,47)40(36,44)45)31-20-33(24-6-4-23(22-48)5-7-24)52-37(31)26-10-16-29(50-2)17-11-26/h4-21H,2-3H3 |
| InChIKey | RNJWVTIUIQWAOA-UHFFFAOYSA-N |
| XLogP | 12.75 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 754.78 |
| LogP ≤ 5 | 12.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|