C45H38F6O8S2 — CID 90389084
3-[2-[2,5-bis(3,5-dimethoxyphenyl)thiophen-3-yl]-3,3,4,4,5,5-hexafluorocyclopenten-1-yl]-2,5-bis(3,5-dimethoxyphenyl)thiophene (PubChem CID 90389084) has the molecular formula C45H38F6O8S2 and a molecular weight of 884.91 g/mol. Its IUPAC name is 3-[2-[2,5-bis(3,5-dimethoxyphenyl)thiophen-3-yl]-3,3,4,4,5,5-hexafluorocyclopenten-1-yl]-2,5-bis(3,5-dimethoxyphenyl)thiophene.
| Compound Name | 3-[2-[2,5-bis(3,5-dimethoxyphenyl)thiophen-3-yl]-3,3,4,4,5,5-hexafluorocyclopenten-1-yl]-2,5-bis(3,5-dimethoxyphenyl)thiophene |
|---|---|
| PubChem CID | 90389084 |
| Molecular Formula | C45H38F6O8S2 |
| Molecular Weight | 884.91 g/mol |
| Exact Mass | 884.19 |
| IUPAC Name | 3-[2-[2,5-bis(3,5-dimethoxyphenyl)thiophen-3-yl]-3,3,4,4,5,5-hexafluorocyclopenten-1-yl]-2,5-bis(3,5-dimethoxyphenyl)thiophene |
| SMILES | COc1cc(OC)cc(-c2cc(C3=C(c4cc(-c5cc(OC)cc(OC)c5)sc4-c4cc(OC)cc(OC)c4)C(F)(F)C(F)(F)C3(F)F)c(-c3cc(OC)cc(OC)c3)s2)c1 |
| InChI | InChI=1S/C45H38F6O8S2/c1-52-27-9-23(10-28(17-27)53-2)37-21-35(41(60-37)25-13-31(56-5)19-32(14-25)57-6)39-40(44(48,49)45(50,51)43(39,46)47)36-22-38(24-11-29(54-3)18-30(12-24)55-4)61-42(36)26-15-33(58-7)20-34(16-26)59-8/h9-22H,1-8H3 |
| InChIKey | XGIWVSZDFMLLPJ-UHFFFAOYSA-N |
| XLogP | 12.38 |
| TPSA | 73.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 884.91 |
| LogP ≤ 5 | 12.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|