C29H16F12O2S2 — CID 21044692
2-[3,3,4,4,5,5-hexafluoro-2-[5-(4-methoxyphenyl)-3-(trifluoromethyl)thiophen-2-yl]cyclopenten-1-yl]-5-(4-methoxyphenyl)-3-(trifluoromethyl)thiophene (PubChem CID 21044692) has the molecular formula C29H16F12O2S2 and a molecular weight of 688.56 g/mol. Its IUPAC name is 2-[3,3,4,4,5,5-hexafluoro-2-[5-(4-methoxyphenyl)-3-(trifluoromethyl)thiophen-2-yl]cyclopenten-1-yl]-5-(4-methoxyphenyl)-3-(trifluoromethyl)thiophene.
| Compound Name | 2-[3,3,4,4,5,5-hexafluoro-2-[5-(4-methoxyphenyl)-3-(trifluoromethyl)thiophen-2-yl]cyclopenten-1-yl]-5-(4-methoxyphenyl)-3-(trifluoromethyl)thiophene |
|---|---|
| PubChem CID | 21044692 |
| Molecular Formula | C29H16F12O2S2 |
| Molecular Weight | 688.56 g/mol |
| Exact Mass | 688.04 |
| IUPAC Name | 2-[3,3,4,4,5,5-hexafluoro-2-[5-(4-methoxyphenyl)-3-(trifluoromethyl)thiophen-2-yl]cyclopenten-1-yl]-5-(4-methoxyphenyl)-3-(trifluoromethyl)thiophene |
| SMILES | COc1ccc(-c2cc(C(F)(F)F)c(C3=C(c4sc(-c5ccc(OC)cc5)cc4C(F)(F)F)C(F)(F)C(F)(F)C3(F)F)s2)cc1 |
| InChI | InChI=1S/C29H16F12O2S2/c1-42-15-7-3-13(4-8-15)19-11-17(27(34,35)36)23(44-19)21-22(26(32,33)29(40,41)25(21,30)31)24-18(28(37,38)39)12-20(45-24)14-5-9-16(43-2)10-6-14/h3-12H,1-2H3 |
| InChIKey | LYZCIDDRUWIOSO-UHFFFAOYSA-N |
| XLogP | 11.03 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 688.56 |
| LogP ≤ 5 | 11.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|