C12H7F7O — CID 11961846
1-(2,3,3,4,4,5,5-heptafluorocyclopenten-1-yl)-4-methoxybenzene (PubChem CID 11961846) has the molecular formula C12H7F7O and a molecular weight of 300.17 g/mol. Its IUPAC name is 1-(2,3,3,4,4,5,5-heptafluorocyclopenten-1-yl)-4-methoxybenzene.
| Compound Name | 1-(2,3,3,4,4,5,5-heptafluorocyclopenten-1-yl)-4-methoxybenzene |
|---|---|
| PubChem CID | 11961846 |
| Molecular Formula | C12H7F7O |
| Molecular Weight | 300.17 g/mol |
| Exact Mass | 300.04 |
| IUPAC Name | 1-(2,3,3,4,4,5,5-heptafluorocyclopenten-1-yl)-4-methoxybenzene |
| SMILES | COc1ccc(C2=C(F)C(F)(F)C(F)(F)C2(F)F)cc1 |
| InChI | InChI=1S/C12H7F7O/c1-20-7-4-2-6(3-5-7)8-9(13)11(16,17)12(18,19)10(8,14)15/h2-5H,1H3 |
| InChIKey | NXOLFUOMJSBJJD-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.17 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|