C13H10F2O — CID 59532996
1,2-difluoro-3-(4-methoxyphenyl)benzene (PubChem CID 59532996) has the molecular formula C13H10F2O and a molecular weight of 220.22 g/mol. Its IUPAC name is 1,2-difluoro-3-(4-methoxyphenyl)benzene.
| Compound Name | 1,2-difluoro-3-(4-methoxyphenyl)benzene |
|---|---|
| PubChem CID | 59532996 |
| Molecular Formula | C13H10F2O |
| Molecular Weight | 220.22 g/mol |
| Exact Mass | 220.07 |
| IUPAC Name | 1,2-difluoro-3-(4-methoxyphenyl)benzene |
| SMILES | COc1ccc(-c2cccc(F)c2F)cc1 |
| InChI | InChI=1S/C13H10F2O/c1-16-10-7-5-9(6-8-10)11-3-2-4-12(14)13(11)15/h2-8H,1H3 |
| InChIKey | WCYIIKATOYXKLR-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.22 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |