C40H34O4S2 — CID 87488450
2-[[2,6-bis(4-methoxyphenyl)phenyl]disulfanyl]-1,3-bis(4-methoxyphenyl)benzene (PubChem CID 87488450) has the molecular formula C40H34O4S2 and a molecular weight of 642.84 g/mol. Its IUPAC name is 2-[[2,6-bis(4-methoxyphenyl)phenyl]disulfanyl]-1,3-bis(4-methoxyphenyl)benzene.
| Compound Name | 2-[[2,6-bis(4-methoxyphenyl)phenyl]disulfanyl]-1,3-bis(4-methoxyphenyl)benzene |
|---|---|
| PubChem CID | 87488450 |
| Molecular Formula | C40H34O4S2 |
| Molecular Weight | 642.84 g/mol |
| Exact Mass | 642.19 |
| IUPAC Name | 2-[[2,6-bis(4-methoxyphenyl)phenyl]disulfanyl]-1,3-bis(4-methoxyphenyl)benzene |
| SMILES | COc1ccc(-c2cccc(-c3ccc(OC)cc3)c2SSc2c(-c3ccc(OC)cc3)cccc2-c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C40H34O4S2/c1-41-31-19-11-27(12-20-31)35-7-5-8-36(28-13-21-32(42-2)22-14-28)39(35)45-46-40-37(29-15-23-33(43-3)24-16-29)9-6-10-38(40)30-17-25-34(44-4)26-18-30/h5-26H,1-4H3 |
| InChIKey | OAHCLHRZNOSLCG-UHFFFAOYSA-N |
| XLogP | 11.19 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.84 |
| LogP ≤ 5 | 11.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|