About 4-(4-methoxyphenyl)-2,3-dihydro-1H-indene
4-(4-methoxyphenyl)-2,3-dihydro-1H-indene (PubChem CID 147099645) has the molecular formula C16H16O
and a molecular weight of 224.30 g/mol. Its IUPAC name is 4-(4-methoxyphenyl)-2,3-dihydro-1H-indene.
Molecular Properties
| Compound Name | 4-(4-methoxyphenyl)-2,3-dihydro-1H-indene |
| PubChem CID | 147099645 |
| Molecular Formula | C16H16O |
| Molecular Weight | 224.30 g/mol |
| Exact Mass | 224.12 |
| IUPAC Name | 4-(4-methoxyphenyl)-2,3-dihydro-1H-indene |
| SMILES | COc1ccc(-c2cccc3c2CCC3)cc1 |
| InChI | InChI=1S/C16H16O/c1-17-14-10-8-13(9-11-14)16-7-3-5-12-4-2-6-15(12)16/h3,5,7-11H,2,4,6H2,1H3 |
| InChIKey | NWLKUQWROBNEJJ-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.30 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4-(4-methoxyphenyl)-2,3-dihydro-1H-indene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(4-methoxyphenyl)-2,3-dihydro-1H-indene?
The IUPAC name of 4-(4-methoxyphenyl)-2,3-dihydro-1H-indene (CID 147099645) is 4-(4-methoxyphenyl)-2,3-dihydro-1H-indene.
What is the SMILES notation for 4-(4-methoxyphenyl)-2,3-dihydro-1H-indene?
The canonical SMILES for 4-(4-methoxyphenyl)-2,3-dihydro-1H-indene is COc1ccc(-c2cccc3c2CCC3)cc1.
What is the InChIKey of 4-(4-methoxyphenyl)-2,3-dihydro-1H-indene?
The InChIKey is NWLKUQWROBNEJJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H16O/c1-17-14-10-8-13(9-11-14)16-7-3-5-12-4-2-6-15(12)16/h3,5,7-11H,2,4,6H2,1H3.
What are the key properties of 4-(4-methoxyphenyl)-2,3-dihydro-1H-indene?
4-(4-methoxyphenyl)-2,3-dihydro-1H-indene has a molecular weight of 224.30 g/mol, XLogP of 3.85, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4-methoxyphenyl)-2,3-dihydro-1H-indene is sourced from PubChem (CID 147099645), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).