C20H19BO4 — CID 175811193
[2,3-bis(4-methoxyphenyl)phenyl]boronic acid (PubChem CID 175811193) has the molecular formula C20H19BO4 and a molecular weight of 334.18 g/mol. Its IUPAC name is [2,3-bis(4-methoxyphenyl)phenyl]boronic acid.
| Compound Name | [2,3-bis(4-methoxyphenyl)phenyl]boronic acid |
|---|---|
| PubChem CID | 175811193 |
| Molecular Formula | C20H19BO4 |
| Molecular Weight | 334.18 g/mol |
| Exact Mass | 334.14 |
| IUPAC Name | [2,3-bis(4-methoxyphenyl)phenyl]boronic acid |
| SMILES | COc1ccc(-c2cccc(B(O)O)c2-c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C20H19BO4/c1-24-16-10-6-14(7-11-16)18-4-3-5-19(21(22)23)20(18)15-8-12-17(25-2)13-9-15/h3-13,22-23H,1-2H3 |
| InChIKey | OMYQNTBZJJSBID-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.18 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|