[2,3-bis(4-methoxyphenyl)phenyl]boronic acid

C20H19BO4 — CID 175811193

IUPAC[2,3-bis(4-methoxyphenyl)phenyl]boronic acid
SMILESCOc1ccc(-c2cccc(B(O)O)c2-c2ccc(OC)cc2)cc1
InChIInChI=1S/C20H19BO4/c1-24-16-10-6-14(7-11-16)18-4-3-5-19(21(22)23)20(18)15-8-12-17(25-2)13-9-15/h3-13,22-23H,1-2H3
InChIKeyOMYQNTBZJJSBID-UHFFFAOYSA-N
MW334.18 g/mol
LogP2.72
Rot. Bonds5

About [2,3-bis(4-methoxyphenyl)phenyl]boronic acid

[2,3-bis(4-methoxyphenyl)phenyl]boronic acid (PubChem CID 175811193) has the molecular formula C20H19BO4 and a molecular weight of 334.18 g/mol. Its IUPAC name is [2,3-bis(4-methoxyphenyl)phenyl]boronic acid.

Molecular Properties

Compound Name[2,3-bis(4-methoxyphenyl)phenyl]boronic acid
PubChem CID175811193
Molecular FormulaC20H19BO4
Molecular Weight334.18 g/mol
Exact Mass334.14
IUPAC Name[2,3-bis(4-methoxyphenyl)phenyl]boronic acid
SMILESCOc1ccc(-c2cccc(B(O)O)c2-c2ccc(OC)cc2)cc1
InChIInChI=1S/C20H19BO4/c1-24-16-10-6-14(7-11-16)18-4-3-5-19(21(22)23)20(18)15-8-12-17(25-2)13-9-15/h3-13,22-23H,1-2H3
InChIKeyOMYQNTBZJJSBID-UHFFFAOYSA-N
XLogP2.72
TPSA58.92 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds5
Heavy Atoms25
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500334.18
LogP ≤ 52.72
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'heavy_metal', 'substructure': 'N/A'}

Analyze [2,3-bis(4-methoxyphenyl)phenyl]boronic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of [2,3-bis(4-methoxyphenyl)phenyl]boronic acid?
The IUPAC name of [2,3-bis(4-methoxyphenyl)phenyl]boronic acid (CID 175811193) is [2,3-bis(4-methoxyphenyl)phenyl]boronic acid.
What is the SMILES notation for [2,3-bis(4-methoxyphenyl)phenyl]boronic acid?
The canonical SMILES for [2,3-bis(4-methoxyphenyl)phenyl]boronic acid is COc1ccc(-c2cccc(B(O)O)c2-c2ccc(OC)cc2)cc1.
What is the InChIKey of [2,3-bis(4-methoxyphenyl)phenyl]boronic acid?
The InChIKey is OMYQNTBZJJSBID-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H19BO4/c1-24-16-10-6-14(7-11-16)18-4-3-5-19(21(22)23)20(18)15-8-12-17(25-2)13-9-15/h3-13,22-23H,1-2H3.
What are the key properties of [2,3-bis(4-methoxyphenyl)phenyl]boronic acid?
[2,3-bis(4-methoxyphenyl)phenyl]boronic acid has a molecular weight of 334.18 g/mol, XLogP of 2.72, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [2,3-bis(4-methoxyphenyl)phenyl]boronic acid is sourced from PubChem (CID 175811193), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).