C25H17Cl3O — CID 57130266
3-chloro-1,2-bis(4-chlorophenyl)-4-(4-methoxyphenyl)benzene (PubChem CID 57130266) has the molecular formula C25H17Cl3O and a molecular weight of 439.77 g/mol. Its IUPAC name is 3-chloro-1,2-bis(4-chlorophenyl)-4-(4-methoxyphenyl)benzene.
| Compound Name | 3-chloro-1,2-bis(4-chlorophenyl)-4-(4-methoxyphenyl)benzene |
|---|---|
| PubChem CID | 57130266 |
| Molecular Formula | C25H17Cl3O |
| Molecular Weight | 439.77 g/mol |
| Exact Mass | 438.03 |
| IUPAC Name | 3-chloro-1,2-bis(4-chlorophenyl)-4-(4-methoxyphenyl)benzene |
| SMILES | COc1ccc(-c2ccc(-c3ccc(Cl)cc3)c(-c3ccc(Cl)cc3)c2Cl)cc1 |
| InChI | InChI=1S/C25H17Cl3O/c1-29-21-12-6-17(7-13-21)23-15-14-22(16-2-8-19(26)9-3-16)24(25(23)28)18-4-10-20(27)11-5-18/h2-15H,1H3 |
| InChIKey | QUWLZUJYFWDMLR-UHFFFAOYSA-N |
| XLogP | 8.66 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.77 |
| LogP ≤ 5 | 8.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |