C18H14Cl2O2 — CID 22048158
1,5-dichloro-2-methoxy-6-(4-methoxyphenyl)naphthalene (PubChem CID 22048158) has the molecular formula C18H14Cl2O2 and a molecular weight of 333.21 g/mol. Its IUPAC name is 1,5-dichloro-2-methoxy-6-(4-methoxyphenyl)naphthalene.
| Compound Name | 1,5-dichloro-2-methoxy-6-(4-methoxyphenyl)naphthalene |
|---|---|
| PubChem CID | 22048158 |
| Molecular Formula | C18H14Cl2O2 |
| Molecular Weight | 333.21 g/mol |
| Exact Mass | 332.04 |
| IUPAC Name | 1,5-dichloro-2-methoxy-6-(4-methoxyphenyl)naphthalene |
| SMILES | COc1ccc(-c2ccc3c(Cl)c(OC)ccc3c2Cl)cc1 |
| InChI | InChI=1S/C18H14Cl2O2/c1-21-12-5-3-11(4-6-12)13-7-8-15-14(17(13)19)9-10-16(22-2)18(15)20/h3-10H,1-2H3 |
| InChIKey | WXOOBAUMMZAVDP-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.21 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |