C9H5Cl3N2O — CID 170552146
2,4,8-trichloro-7-methoxyquinazoline (PubChem CID 170552146) has the molecular formula C9H5Cl3N2O and a molecular weight of 263.51 g/mol. Its IUPAC name is 2,4,8-trichloro-7-methoxyquinazoline.
| Compound Name | 2,4,8-trichloro-7-methoxyquinazoline |
|---|---|
| PubChem CID | 170552146 |
| Molecular Formula | C9H5Cl3N2O |
| Molecular Weight | 263.51 g/mol |
| Exact Mass | 261.95 |
| IUPAC Name | 2,4,8-trichloro-7-methoxyquinazoline |
| SMILES | COc1ccc2c(Cl)nc(Cl)nc2c1Cl |
| InChI | InChI=1S/C9H5Cl3N2O/c1-15-5-3-2-4-7(6(5)10)13-9(12)14-8(4)11/h2-3H,1H3 |
| InChIKey | KCSNEPMOTCQVJB-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.51 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |