C11H9Cl2NO — CID 171373308
4,8-dichloro-7-methoxy-3-methylquinoline (PubChem CID 171373308) has the molecular formula C11H9Cl2NO and a molecular weight of 242.10 g/mol. Its IUPAC name is 4,8-dichloro-7-methoxy-3-methylquinoline.
| Compound Name | 4,8-dichloro-7-methoxy-3-methylquinoline |
|---|---|
| PubChem CID | 171373308 |
| Molecular Formula | C11H9Cl2NO |
| Molecular Weight | 242.10 g/mol |
| Exact Mass | 241.01 |
| IUPAC Name | 4,8-dichloro-7-methoxy-3-methylquinoline |
| SMILES | COc1ccc2c(Cl)c(C)cnc2c1Cl |
| InChI | InChI=1S/C11H9Cl2NO/c1-6-5-14-11-7(9(6)12)3-4-8(15-2)10(11)13/h3-5H,1-2H3 |
| InChIKey | QHIDYPQBINJODP-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.10 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |