C12H12ClNO — CID 171373217
4-chloro-6-methoxy-3,8-dimethylquinoline (PubChem CID 171373217) has the molecular formula C12H12ClNO and a molecular weight of 221.69 g/mol. Its IUPAC name is 4-chloro-6-methoxy-3,8-dimethylquinoline.
| Compound Name | 4-chloro-6-methoxy-3,8-dimethylquinoline |
|---|---|
| PubChem CID | 171373217 |
| Molecular Formula | C12H12ClNO |
| Molecular Weight | 221.69 g/mol |
| Exact Mass | 221.06 |
| IUPAC Name | 4-chloro-6-methoxy-3,8-dimethylquinoline |
| SMILES | COc1cc(C)c2ncc(C)c(Cl)c2c1 |
| InChI | InChI=1S/C12H12ClNO/c1-7-4-9(15-3)5-10-11(13)8(2)6-14-12(7)10/h4-6H,1-3H3 |
| InChIKey | PVGJYVVPAQKJMB-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.69 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |