C11H8ClF2N — CID 171373268
4-chloro-6,8-difluoro-3,7-dimethylquinoline (PubChem CID 171373268) has the molecular formula C11H8ClF2N and a molecular weight of 227.64 g/mol. Its IUPAC name is 4-chloro-6,8-difluoro-3,7-dimethylquinoline.
| Compound Name | 4-chloro-6,8-difluoro-3,7-dimethylquinoline |
|---|---|
| PubChem CID | 171373268 |
| Molecular Formula | C11H8ClF2N |
| Molecular Weight | 227.64 g/mol |
| Exact Mass | 227.03 |
| IUPAC Name | 4-chloro-6,8-difluoro-3,7-dimethylquinoline |
| SMILES | Cc1cnc2c(F)c(C)c(F)cc2c1Cl |
| InChI | InChI=1S/C11H8ClF2N/c1-5-4-15-11-7(9(5)12)3-8(13)6(2)10(11)14/h3-4H,1-2H3 |
| InChIKey | IXFWJTGXDAPDQS-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.64 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |