C11H10ClFN2 — CID 125425900
4-chloro-6-fluoro-3,7-dimethylquinolin-8-amine (PubChem CID 125425900) has the molecular formula C11H10ClFN2 and a molecular weight of 224.67 g/mol. Its IUPAC name is 4-chloro-6-fluoro-3,7-dimethylquinolin-8-amine.
| Compound Name | 4-chloro-6-fluoro-3,7-dimethylquinolin-8-amine |
|---|---|
| PubChem CID | 125425900 |
| Molecular Formula | C11H10ClFN2 |
| Molecular Weight | 224.67 g/mol |
| Exact Mass | 224.05 |
| IUPAC Name | 4-chloro-6-fluoro-3,7-dimethylquinolin-8-amine |
| SMILES | Cc1cnc2c(N)c(C)c(F)cc2c1Cl |
| InChI | InChI=1S/C11H10ClFN2/c1-5-4-15-11-7(9(5)12)3-8(13)6(2)10(11)14/h3-4H,14H2,1-2H3 |
| InChIKey | OQJKLEUKBDANGJ-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.67 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|