C11H11ClN2 — CID 125425329
4-chloro-3,7-dimethylquinolin-8-amine (PubChem CID 125425329) has the molecular formula C11H11ClN2 and a molecular weight of 206.68 g/mol. Its IUPAC name is 4-chloro-3,7-dimethylquinolin-8-amine.
| Compound Name | 4-chloro-3,7-dimethylquinolin-8-amine |
|---|---|
| PubChem CID | 125425329 |
| Molecular Formula | C11H11ClN2 |
| Molecular Weight | 206.68 g/mol |
| Exact Mass | 206.06 |
| IUPAC Name | 4-chloro-3,7-dimethylquinolin-8-amine |
| SMILES | Cc1cnc2c(N)c(C)ccc2c1Cl |
| InChI | InChI=1S/C11H11ClN2/c1-6-3-4-8-9(12)7(2)5-14-11(8)10(6)13/h3-5H,13H2,1-2H3 |
| InChIKey | BGFODBHHLHFTAB-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.68 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|