C10H5Cl3FN — CID 171373330
4,6,7-trichloro-8-fluoro-3-methylquinoline (PubChem CID 171373330) has the molecular formula C10H5Cl3FN and a molecular weight of 264.51 g/mol. Its IUPAC name is 4,6,7-trichloro-8-fluoro-3-methylquinoline.
| Compound Name | 4,6,7-trichloro-8-fluoro-3-methylquinoline |
|---|---|
| PubChem CID | 171373330 |
| Molecular Formula | C10H5Cl3FN |
| Molecular Weight | 264.51 g/mol |
| Exact Mass | 262.95 |
| IUPAC Name | 4,6,7-trichloro-8-fluoro-3-methylquinoline |
| SMILES | Cc1cnc2c(F)c(Cl)c(Cl)cc2c1Cl |
| InChI | InChI=1S/C10H5Cl3FN/c1-4-3-15-10-5(7(4)12)2-6(11)8(13)9(10)14/h2-3H,1H3 |
| InChIKey | APJLOTAUEFTXEI-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.51 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|