C10H5BrClF2N — CID 171373376
8-bromo-4-chloro-6,7-difluoro-3-methylquinoline (PubChem CID 171373376) has the molecular formula C10H5BrClF2N and a molecular weight of 292.51 g/mol. Its IUPAC name is 8-bromo-4-chloro-6,7-difluoro-3-methylquinoline.
| Compound Name | 8-bromo-4-chloro-6,7-difluoro-3-methylquinoline |
|---|---|
| PubChem CID | 171373376 |
| Molecular Formula | C10H5BrClF2N |
| Molecular Weight | 292.51 g/mol |
| Exact Mass | 290.93 |
| IUPAC Name | 8-bromo-4-chloro-6,7-difluoro-3-methylquinoline |
| SMILES | Cc1cnc2c(Br)c(F)c(F)cc2c1Cl |
| InChI | InChI=1S/C10H5BrClF2N/c1-4-3-15-10-5(8(4)12)2-6(13)9(14)7(10)11/h2-3H,1H3 |
| InChIKey | LOZZWKVMDTVXAA-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.51 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|