C11H8ClF2NO — CID 171373414
4-chloro-7,8-difluoro-6-methoxy-3-methylquinoline (PubChem CID 171373414) has the molecular formula C11H8ClF2NO and a molecular weight of 243.64 g/mol. Its IUPAC name is 4-chloro-7,8-difluoro-6-methoxy-3-methylquinoline.
| Compound Name | 4-chloro-7,8-difluoro-6-methoxy-3-methylquinoline |
|---|---|
| PubChem CID | 171373414 |
| Molecular Formula | C11H8ClF2NO |
| Molecular Weight | 243.64 g/mol |
| Exact Mass | 243.03 |
| IUPAC Name | 4-chloro-7,8-difluoro-6-methoxy-3-methylquinoline |
| SMILES | COc1cc2c(Cl)c(C)cnc2c(F)c1F |
| InChI | InChI=1S/C11H8ClF2NO/c1-5-4-15-11-6(8(5)12)3-7(16-2)9(13)10(11)14/h3-4H,1-2H3 |
| InChIKey | FEFUMJWXCUBVAZ-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.64 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |