C11H6Cl2N2O — CID 12559432
4,8-dichloro-7-methoxyquinoline-3-carbonitrile (PubChem CID 12559432) has the molecular formula C11H6Cl2N2O and a molecular weight of 253.09 g/mol. Its IUPAC name is 4,8-dichloro-7-methoxyquinoline-3-carbonitrile.
| Compound Name | 4,8-dichloro-7-methoxyquinoline-3-carbonitrile |
|---|---|
| PubChem CID | 12559432 |
| Molecular Formula | C11H6Cl2N2O |
| Molecular Weight | 253.09 g/mol |
| Exact Mass | 251.99 |
| IUPAC Name | 4,8-dichloro-7-methoxyquinoline-3-carbonitrile |
| SMILES | COc1ccc2c(Cl)c(C#N)cnc2c1Cl |
| InChI | InChI=1S/C11H6Cl2N2O/c1-16-8-3-2-7-9(12)6(4-14)5-15-11(7)10(8)13/h2-3,5H,1H3 |
| InChIKey | SJDBDZVEAUDGBL-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 45.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.09 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |