C9H3ClIN3 — CID 102941564
4-chloro-8-iodo-1,6-naphthyridine-3-carbonitrile (PubChem CID 102941564) has the molecular formula C9H3ClIN3 and a molecular weight of 315.50 g/mol. Its IUPAC name is 4-chloro-8-iodo-1,6-naphthyridine-3-carbonitrile.
| Compound Name | 4-chloro-8-iodo-1,6-naphthyridine-3-carbonitrile |
|---|---|
| PubChem CID | 102941564 |
| Molecular Formula | C9H3ClIN3 |
| Molecular Weight | 315.50 g/mol |
| Exact Mass | 314.91 |
| IUPAC Name | 4-chloro-8-iodo-1,6-naphthyridine-3-carbonitrile |
| SMILES | N#Cc1cnc2c(I)cncc2c1Cl |
| InChI | InChI=1S/C9H3ClIN3/c10-8-5(1-12)2-14-9-6(8)3-13-4-7(9)11/h2-4H |
| InChIKey | PBIKGGCWLQHHEQ-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 49.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.50 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|