C10H5ClN2O2 — CID 135742179
4-chloro-6,7-dihydroxyquinoline-3-carbonitrile (PubChem CID 135742179) has the molecular formula C10H5ClN2O2 and a molecular weight of 220.62 g/mol. Its IUPAC name is 4-chloro-6,7-dihydroxyquinoline-3-carbonitrile.
| Compound Name | 4-chloro-6,7-dihydroxyquinoline-3-carbonitrile |
|---|---|
| PubChem CID | 135742179 |
| Molecular Formula | C10H5ClN2O2 |
| Molecular Weight | 220.62 g/mol |
| Exact Mass | 220.00 |
| IUPAC Name | 4-chloro-6,7-dihydroxyquinoline-3-carbonitrile |
| SMILES | N#Cc1cnc2cc(O)c(O)cc2c1Cl |
| InChI | InChI=1S/C10H5ClN2O2/c11-10-5(3-12)4-13-7-2-9(15)8(14)1-6(7)10/h1-2,4,14-15H |
| InChIKey | NBJYSPJQMCMCDA-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 77.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.62 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|