C8H3ClN2O2 — CID 150094247
4-chloro-3,5-dihydroxybenzene-1,2-dicarbonitrile (PubChem CID 150094247) has the molecular formula C8H3ClN2O2 and a molecular weight of 194.58 g/mol. Its IUPAC name is 4-chloro-3,5-dihydroxybenzene-1,2-dicarbonitrile.
| Compound Name | 4-chloro-3,5-dihydroxybenzene-1,2-dicarbonitrile |
|---|---|
| PubChem CID | 150094247 |
| Molecular Formula | C8H3ClN2O2 |
| Molecular Weight | 194.58 g/mol |
| Exact Mass | 193.99 |
| IUPAC Name | 4-chloro-3,5-dihydroxybenzene-1,2-dicarbonitrile |
| SMILES | N#Cc1cc(O)c(Cl)c(O)c1C#N |
| InChI | InChI=1S/C8H3ClN2O2/c9-7-6(12)1-4(2-10)5(3-11)8(7)13/h1,12-13H |
| InChIKey | DTWLYWSHQUSBCU-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 88.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.58 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |