C11H10N2O3 — CID 90015356
4,5-dihydroxy-2-(3-hydroxypropyl)benzene-1,3-dicarbonitrile (PubChem CID 90015356) has the molecular formula C11H10N2O3 and a molecular weight of 218.21 g/mol. Its IUPAC name is 4,5-dihydroxy-2-(3-hydroxypropyl)benzene-1,3-dicarbonitrile.
| Compound Name | 4,5-dihydroxy-2-(3-hydroxypropyl)benzene-1,3-dicarbonitrile |
|---|---|
| PubChem CID | 90015356 |
| Molecular Formula | C11H10N2O3 |
| Molecular Weight | 218.21 g/mol |
| Exact Mass | 218.07 |
| IUPAC Name | 4,5-dihydroxy-2-(3-hydroxypropyl)benzene-1,3-dicarbonitrile |
| SMILES | N#Cc1cc(O)c(O)c(C#N)c1CCCO |
| InChI | InChI=1S/C11H10N2O3/c12-5-7-4-10(15)11(16)9(6-13)8(7)2-1-3-14/h4,14-16H,1-3H2 |
| InChIKey | UIVPKENTVBSTHA-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 108.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.21 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|