C17H14N2O2 — CID 72547802
4,5-dihydroxy-2-(4-propylphenyl)benzene-1,3-dicarbonitrile (PubChem CID 72547802) has the molecular formula C17H14N2O2 and a molecular weight of 278.31 g/mol. Its IUPAC name is 4,5-dihydroxy-2-(4-propylphenyl)benzene-1,3-dicarbonitrile.
| Compound Name | 4,5-dihydroxy-2-(4-propylphenyl)benzene-1,3-dicarbonitrile |
|---|---|
| PubChem CID | 72547802 |
| Molecular Formula | C17H14N2O2 |
| Molecular Weight | 278.31 g/mol |
| Exact Mass | 278.11 |
| IUPAC Name | 4,5-dihydroxy-2-(4-propylphenyl)benzene-1,3-dicarbonitrile |
| SMILES | CCCc1ccc(-c2c(C#N)cc(O)c(O)c2C#N)cc1 |
| InChI | InChI=1S/C17H14N2O2/c1-2-3-11-4-6-12(7-5-11)16-13(9-18)8-15(20)17(21)14(16)10-19/h4-8,20-21H,2-3H2,1H3 |
| InChIKey | SWNSRZVRUTWKEZ-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 88.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.31 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|