C15H10N2O2 — CID 72550789
2-benzyl-4,5-dihydroxybenzene-1,3-dicarbonitrile (PubChem CID 72550789) has the molecular formula C15H10N2O2 and a molecular weight of 250.26 g/mol. Its IUPAC name is 2-benzyl-4,5-dihydroxybenzene-1,3-dicarbonitrile.
| Compound Name | 2-benzyl-4,5-dihydroxybenzene-1,3-dicarbonitrile |
|---|---|
| PubChem CID | 72550789 |
| Molecular Formula | C15H10N2O2 |
| Molecular Weight | 250.26 g/mol |
| Exact Mass | 250.07 |
| IUPAC Name | 2-benzyl-4,5-dihydroxybenzene-1,3-dicarbonitrile |
| SMILES | N#Cc1cc(O)c(O)c(C#N)c1Cc1ccccc1 |
| InChI | InChI=1S/C15H10N2O2/c16-8-11-7-14(18)15(19)13(9-17)12(11)6-10-4-2-1-3-5-10/h1-5,7,18-19H,6H2 |
| InChIKey | NCWPQCRHFDKGJC-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 88.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.26 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|