C16H10N2O5 — CID 72548513
5-[(2,6-dicyano-3,4-dihydroxyphenyl)methyl]-2-hydroxybenzoic acid (PubChem CID 72548513) has the molecular formula C16H10N2O5 and a molecular weight of 310.27 g/mol. Its IUPAC name is 5-[(2,6-dicyano-3,4-dihydroxyphenyl)methyl]-2-hydroxybenzoic acid.
| Compound Name | 5-[(2,6-dicyano-3,4-dihydroxyphenyl)methyl]-2-hydroxybenzoic acid |
|---|---|
| PubChem CID | 72548513 |
| Molecular Formula | C16H10N2O5 |
| Molecular Weight | 310.27 g/mol |
| Exact Mass | 310.06 |
| IUPAC Name | 5-[(2,6-dicyano-3,4-dihydroxyphenyl)methyl]-2-hydroxybenzoic acid |
| SMILES | N#Cc1cc(O)c(O)c(C#N)c1Cc1ccc(O)c(C(=O)O)c1 |
| InChI | InChI=1S/C16H10N2O5/c17-6-9-5-14(20)15(21)12(7-18)10(9)3-8-1-2-13(19)11(4-8)16(22)23/h1-2,4-5,19-21H,3H2,(H,22,23) |
| InChIKey | KJDGITYGUGHUQW-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 145.57 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.27 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|