C16H10N2O4 — CID 90015431
2-[4-(2,6-dicyano-3,4-dihydroxyphenyl)phenyl]acetic acid (PubChem CID 90015431) has the molecular formula C16H10N2O4 and a molecular weight of 294.27 g/mol. Its IUPAC name is 2-[4-(2,6-dicyano-3,4-dihydroxyphenyl)phenyl]acetic acid.
| Compound Name | 2-[4-(2,6-dicyano-3,4-dihydroxyphenyl)phenyl]acetic acid |
|---|---|
| PubChem CID | 90015431 |
| Molecular Formula | C16H10N2O4 |
| Molecular Weight | 294.27 g/mol |
| Exact Mass | 294.06 |
| IUPAC Name | 2-[4-(2,6-dicyano-3,4-dihydroxyphenyl)phenyl]acetic acid |
| SMILES | N#Cc1cc(O)c(O)c(C#N)c1-c1ccc(CC(=O)O)cc1 |
| InChI | InChI=1S/C16H10N2O4/c17-7-11-6-13(19)16(22)12(8-18)15(11)10-3-1-9(2-4-10)5-14(20)21/h1-4,6,19,22H,5H2,(H,20,21) |
| InChIKey | QZUIYZVEMXOUTC-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 125.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.27 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|