C14H5F3N2O2 — CID 90015593
4,5-dihydroxy-2-(3,4,5-trifluorophenyl)benzene-1,3-dicarbonitrile (PubChem CID 90015593) has the molecular formula C14H5F3N2O2 and a molecular weight of 290.20 g/mol. Its IUPAC name is 4,5-dihydroxy-2-(3,4,5-trifluorophenyl)benzene-1,3-dicarbonitrile.
| Compound Name | 4,5-dihydroxy-2-(3,4,5-trifluorophenyl)benzene-1,3-dicarbonitrile |
|---|---|
| PubChem CID | 90015593 |
| Molecular Formula | C14H5F3N2O2 |
| Molecular Weight | 290.20 g/mol |
| Exact Mass | 290.03 |
| IUPAC Name | 4,5-dihydroxy-2-(3,4,5-trifluorophenyl)benzene-1,3-dicarbonitrile |
| SMILES | N#Cc1cc(O)c(O)c(C#N)c1-c1cc(F)c(F)c(F)c1 |
| InChI | InChI=1S/C14H5F3N2O2/c15-9-1-6(2-10(16)13(9)17)12-7(4-18)3-11(20)14(21)8(12)5-19/h1-3,20-21H |
| InChIKey | BRAMRFWKZTXEEK-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 88.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.20 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|