C7H2F3N — CID 2776998
2,3,5-trifluorobenzonitrile (PubChem CID 2776998) has the molecular formula C7H2F3N and a molecular weight of 157.09 g/mol. Its IUPAC name is 2,3,5-trifluorobenzonitrile.
| Compound Name | 2,3,5-trifluorobenzonitrile |
|---|---|
| PubChem CID | 2776998 |
| Molecular Formula | C7H2F3N |
| Molecular Weight | 157.09 g/mol |
| Exact Mass | 157.01 |
| IUPAC Name | 2,3,5-trifluorobenzonitrile |
| SMILES | N#Cc1cc(F)cc(F)c1F |
| InChI | InChI=1S/C7H2F3N/c8-5-1-4(3-11)7(10)6(9)2-5/h1-2H |
| InChIKey | MMPKVFQMDMBXSG-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 157.09 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|