C8H2ClF2NO — CID 131072058
2-cyano-4,6-difluorobenzoyl chloride (PubChem CID 131072058) has the molecular formula C8H2ClF2NO and a molecular weight of 201.56 g/mol. Its IUPAC name is 2-cyano-4,6-difluorobenzoyl chloride.
| Compound Name | 2-cyano-4,6-difluorobenzoyl chloride |
|---|---|
| PubChem CID | 131072058 |
| Molecular Formula | C8H2ClF2NO |
| Molecular Weight | 201.56 g/mol |
| Exact Mass | 200.98 |
| IUPAC Name | 2-cyano-4,6-difluorobenzoyl chloride |
| SMILES | N#Cc1cc(F)cc(F)c1C(=O)Cl |
| InChI | InChI=1S/C8H2ClF2NO/c9-8(13)7-4(3-12)1-5(10)2-6(7)11/h1-2H |
| InChIKey | FJJIALWRNYCONZ-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 40.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.56 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|