C8H5F2NS — CID 117280034
2,5-difluoro-3-methylsulfanylbenzonitrile (PubChem CID 117280034) has the molecular formula C8H5F2NS and a molecular weight of 185.20 g/mol. Its IUPAC name is 2,5-difluoro-3-methylsulfanylbenzonitrile.
| Compound Name | 2,5-difluoro-3-methylsulfanylbenzonitrile |
|---|---|
| PubChem CID | 117280034 |
| Molecular Formula | C8H5F2NS |
| Molecular Weight | 185.20 g/mol |
| Exact Mass | 185.01 |
| IUPAC Name | 2,5-difluoro-3-methylsulfanylbenzonitrile |
| SMILES | CSc1cc(F)cc(C#N)c1F |
| InChI | InChI=1S/C8H5F2NS/c1-12-7-3-6(9)2-5(4-11)8(7)10/h2-3H,1H3 |
| InChIKey | IAJMEUKOTMMUNO-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.20 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |